C35H37Cl2N3O2 — CID 118411699
N-[1-[(4-chlorophenyl)methylamino]-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]-4-phenylbenzamide;hydrochloride (PubChem CID 118411699) has the molecular formula C35H37Cl2N3O2 and a molecular weight of 602.61 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methylamino]-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]-4-phenylbenzamide;hydrochloride.
| Compound Name | N-[1-[(4-chlorophenyl)methylamino]-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]-4-phenylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 118411699 |
| Molecular Formula | C35H37Cl2N3O2 |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methylamino]-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]-4-phenylbenzamide;hydrochloride |
| SMILES | Cl.O=C(NC(CCCCN[C@@H]1C[C@H]1c1ccccc1)C(=O)NCc1ccc(Cl)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H36ClN3O2.ClH/c36-30-20-14-25(15-21-30)24-38-35(41)32(13-7-8-22-37-33-23-31(33)28-11-5-2-6-12-28)39-34(40)29-18-16-27(17-19-29)26-9-3-1-4-10-26;/h1-6,9-12,14-21,31-33,37H,7-8,13,22-24H2,(H,38,41)(H,39,40);1H/t31-,32?,33+;/m0./s1 |
| InChIKey | RIAXAOZRBVBBNJ-YVWZOWDPSA-N |
| XLogP | 7.16 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|