C22H29N3O — CID 74538696
2-amino-N-benzyl-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexanamide (PubChem CID 74538696) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-amino-N-benzyl-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexanamide.
| Compound Name | 2-amino-N-benzyl-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexanamide |
|---|---|
| PubChem CID | 74538696 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-amino-N-benzyl-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexanamide |
| SMILES | NC(CCCCN[C@@H]1C[C@H]1c1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H29N3O/c23-20(22(26)25-16-17-9-3-1-4-10-17)13-7-8-14-24-21-15-19(21)18-11-5-2-6-12-18/h1-6,9-12,19-21,24H,7-8,13-16,23H2,(H,25,26)/t19-,20?,21+/m0/s1 |
| InChIKey | HCWMJOOUZXUERQ-SIGULFFNSA-N |
| XLogP | 2.95 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|