C23H33Cl2N3O — CID 118411668
2-amino-N-[(3-methylphenyl)methyl]-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexanamide;dihydrochloride (PubChem CID 118411668) has the molecular formula C23H33Cl2N3O and a molecular weight of 438.44 g/mol. Its IUPAC name is 2-amino-N-[(3-methylphenyl)methyl]-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexanamide;dihydrochloride.
| Compound Name | 2-amino-N-[(3-methylphenyl)methyl]-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 118411668 |
| Molecular Formula | C23H33Cl2N3O |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-amino-N-[(3-methylphenyl)methyl]-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexanamide;dihydrochloride |
| SMILES | Cc1cccc(CNC(=O)C(N)CCCCN[C@@H]2C[C@H]2c2ccccc2)c1.Cl.Cl |
| InChI | InChI=1S/C23H31N3O.2ClH/c1-17-8-7-9-18(14-17)16-26-23(27)21(24)12-5-6-13-25-22-15-20(22)19-10-3-2-4-11-19;;/h2-4,7-11,14,20-22,25H,5-6,12-13,15-16,24H2,1H3,(H,26,27);2*1H/t20-,21?,22+;;/m0../s1 |
| InChIKey | TYHBQKFKWVVPFG-FLCZVBEXSA-N |
| XLogP | 4.10 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|