C37H40N2O2 — CID 147698647
N-[(2S)-1-[(3-methylphenyl)methylamino]-1-oxo-7-(2-phenylcyclopropyl)heptan-2-yl]-4-phenylbenzamide (PubChem CID 147698647) has the molecular formula C37H40N2O2 and a molecular weight of 544.74 g/mol. Its IUPAC name is N-[(2S)-1-[(3-methylphenyl)methylamino]-1-oxo-7-(2-phenylcyclopropyl)heptan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[(2S)-1-[(3-methylphenyl)methylamino]-1-oxo-7-(2-phenylcyclopropyl)heptan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 147698647 |
| Molecular Formula | C37H40N2O2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | N-[(2S)-1-[(3-methylphenyl)methylamino]-1-oxo-7-(2-phenylcyclopropyl)heptan-2-yl]-4-phenylbenzamide |
| SMILES | Cc1cccc(CNC(=O)[C@H](CCCCCC2CC2c2ccccc2)NC(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C37H40N2O2/c1-27-12-11-13-28(24-27)26-38-37(41)35(19-10-4-9-18-33-25-34(33)31-16-7-3-8-17-31)39-36(40)32-22-20-30(21-23-32)29-14-5-2-6-15-29/h2-3,5-8,11-17,20-24,33-35H,4,9-10,18-19,25-26H2,1H3,(H,38,41)(H,39,40)/t33?,34?,35-/m0/s1 |
| InChIKey | GSKNEWGJUOGVHF-YLNHBKTGSA-N |
| XLogP | 7.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|