C30H33ClF3N3O2 — CID 118411675
N-[1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]-4-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 118411675) has the molecular formula C30H33ClF3N3O2 and a molecular weight of 560.06 g/mol. Its IUPAC name is N-[1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]-4-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | N-[1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]-4-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 118411675 |
| Molecular Formula | C30H33ClF3N3O2 |
| Molecular Weight | 560.06 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | N-[1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]-4-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NC(CCCCN[C@@H]1C[C@H]1c1ccccc1)C(=O)NCc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H32F3N3O2.ClH/c31-30(32,33)24-16-14-23(15-17-24)28(37)36-26(29(38)35-20-21-9-3-1-4-10-21)13-7-8-18-34-27-19-25(27)22-11-5-2-6-12-22;/h1-6,9-12,14-17,25-27,34H,7-8,13,18-20H2,(H,35,38)(H,36,37);1H/t25-,26?,27+;/m0./s1 |
| InChIKey | FYCGUDXZXGLYOI-UYNIGDKGSA-N |
| XLogP | 5.86 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.06 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|