C30H36N4O2 — CID 118423036
N-[(2S)-1-[amino(benzyl)amino]-1-oxo-6-[(2-phenylcyclopropyl)amino]hexan-2-yl]-4-methylbenzamide (PubChem CID 118423036) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-[(2S)-1-[amino(benzyl)amino]-1-oxo-6-[(2-phenylcyclopropyl)amino]hexan-2-yl]-4-methylbenzamide.
| Compound Name | N-[(2S)-1-[amino(benzyl)amino]-1-oxo-6-[(2-phenylcyclopropyl)amino]hexan-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 118423036 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | N-[(2S)-1-[amino(benzyl)amino]-1-oxo-6-[(2-phenylcyclopropyl)amino]hexan-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](CCCCNC2CC2c2ccccc2)C(=O)N(N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N4O2/c1-22-15-17-25(18-16-22)29(35)33-27(30(36)34(31)21-23-10-4-2-5-11-23)14-8-9-19-32-28-20-26(28)24-12-6-3-7-13-24/h2-7,10-13,15-18,26-28,32H,8-9,14,19-21,31H2,1H3,(H,33,35)/t26?,27-,28?/m0/s1 |
| InChIKey | OILMUPDWSBKIBA-XLQDAESGSA-N |
| XLogP | 4.31 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|