C29H37N5O2 — CID 157180412
4-cyano-N-[(2S)-1-(4-ethylpiperazin-1-yl)-5-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxopentan-2-yl]benzamide (PubChem CID 157180412) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 4-cyano-N-[(2S)-1-(4-ethylpiperazin-1-yl)-5-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-cyano-N-[(2S)-1-(4-ethylpiperazin-1-yl)-5-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 157180412 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 4-cyano-N-[(2S)-1-(4-ethylpiperazin-1-yl)-5-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxopentan-2-yl]benzamide |
| SMILES | CCN1CCN(C(=O)[C@H](CCCN[C@@H]2C[C@H]2c2ccc(C)cc2)NC(=O)c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C29H37N5O2/c1-3-33-15-17-34(18-16-33)29(36)26(32-28(35)24-12-8-22(20-30)9-13-24)5-4-14-31-27-19-25(27)23-10-6-21(2)7-11-23/h6-13,25-27,31H,3-5,14-19H2,1-2H3,(H,32,35)/t25-,26-,27+/m0/s1 |
| InChIKey | RJJKOFXMVBEKLG-GMQQYTKMSA-N |
| XLogP | 3.06 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|