C28H38N4O2 — CID 163913676
4-methyl-N-[(2S)-5-[[(1S,2R)-2-(4-methylphenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide (PubChem CID 163913676) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 4-methyl-N-[(2S)-5-[[(1S,2R)-2-(4-methylphenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-methyl-N-[(2S)-5-[[(1S,2R)-2-(4-methylphenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 163913676 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 4-methyl-N-[(2S)-5-[[(1S,2R)-2-(4-methylphenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](CCCN[C@H]2C[C@@H]2c2ccc(C)cc2)C(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C28H38N4O2/c1-20-6-10-22(11-7-20)24-19-26(24)29-14-4-5-25(28(34)32-17-15-31(3)16-18-32)30-27(33)23-12-8-21(2)9-13-23/h6-13,24-26,29H,4-5,14-19H2,1-3H3,(H,30,33)/t24-,25+,26+/m1/s1 |
| InChIKey | QUJMLLWYRVLKGQ-ZNZIZOMTSA-N |
| XLogP | 3.10 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|