C33H40N4O2 — CID 122494470
N-[(2S)-6-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylhexan-2-yl]-4-phenylbenzamide (PubChem CID 122494470) has the molecular formula C33H40N4O2 and a molecular weight of 524.71 g/mol. Its IUPAC name is N-[(2S)-6-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylhexan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[(2S)-6-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylhexan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 122494470 |
| Molecular Formula | C33H40N4O2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | N-[(2S)-6-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylhexan-2-yl]-4-phenylbenzamide |
| SMILES | Cc1ccc([C@@H]2C[C@H]2NCCCC[C@H](NC(=O)c2ccc(-c3ccccc3)cc2)C(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C33H40N4O2/c1-24-10-12-27(13-11-24)29-23-31(29)35-18-6-5-9-30(33(39)37-21-19-34-20-22-37)36-32(38)28-16-14-26(15-17-28)25-7-3-2-4-8-25/h2-4,7-8,10-17,29-31,34-35H,5-6,9,18-23H2,1H3,(H,36,38)/t29-,30-,31+/m0/s1 |
| InChIKey | DZMFHKFYLIKURO-RWSKJCERSA-N |
| XLogP | 4.51 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|