C34H42N4O5S — CID 129125107
N-[(2S)-6-[[(2S)-2-(4-methoxyphenyl)cyclopropyl]amino]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxohexan-2-yl]-4-phenylbenzamide (PubChem CID 129125107) has the molecular formula C34H42N4O5S and a molecular weight of 618.80 g/mol. Its IUPAC name is N-[(2S)-6-[[(2S)-2-(4-methoxyphenyl)cyclopropyl]amino]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxohexan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[(2S)-6-[[(2S)-2-(4-methoxyphenyl)cyclopropyl]amino]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxohexan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 129125107 |
| Molecular Formula | C34H42N4O5S |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | N-[(2S)-6-[[(2S)-2-(4-methoxyphenyl)cyclopropyl]amino]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxohexan-2-yl]-4-phenylbenzamide |
| SMILES | COc1ccc([C@@H]2CC2NCCCC[C@H](NC(=O)c2ccc(-c3ccccc3)cc2)C(=O)N2CCN(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C34H42N4O5S/c1-43-29-17-15-27(16-18-29)30-24-32(30)35-19-7-6-10-31(34(40)37-20-22-38(23-21-37)44(2,41)42)36-33(39)28-13-11-26(12-14-28)25-8-4-3-5-9-25/h3-5,8-9,11-18,30-32,35H,6-7,10,19-24H2,1-2H3,(H,36,39)/t30-,31-,32?/m0/s1 |
| InChIKey | MWPGMKLDVHBQEY-PZWBPPBVSA-N |
| XLogP | 3.88 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|