C41H42ClN3O2 — CID 118411687
N-[1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]-1-[(3-phenylphenyl)methylamino]hexan-2-yl]-4-phenylbenzamide;hydrochloride (PubChem CID 118411687) has the molecular formula C41H42ClN3O2 and a molecular weight of 644.26 g/mol. Its IUPAC name is N-[1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]-1-[(3-phenylphenyl)methylamino]hexan-2-yl]-4-phenylbenzamide;hydrochloride.
| Compound Name | N-[1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]-1-[(3-phenylphenyl)methylamino]hexan-2-yl]-4-phenylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 118411687 |
| Molecular Formula | C41H42ClN3O2 |
| Molecular Weight | 644.26 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | N-[1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]-1-[(3-phenylphenyl)methylamino]hexan-2-yl]-4-phenylbenzamide;hydrochloride |
| SMILES | Cl.O=C(NC(CCCCN[C@@H]1C[C@H]1c1ccccc1)C(=O)NCc1cccc(-c2ccccc2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C41H41N3O2.ClH/c45-40(35-24-22-33(23-25-35)31-14-4-1-5-15-31)44-38(21-10-11-26-42-39-28-37(39)34-18-8-3-9-19-34)41(46)43-29-30-13-12-20-36(27-30)32-16-6-2-7-17-32;/h1-9,12-20,22-25,27,37-39,42H,10-11,21,26,28-29H2,(H,43,46)(H,44,45);1H/t37-,38?,39+;/m0./s1 |
| InChIKey | JJWSJVWGLWGOLB-UBCPUCGZSA-N |
| XLogP | 8.17 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.26 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|