C23H28F3N3O — CID 118411694
2-amino-6-[[(1R,2S)-2-phenylcyclopropyl]amino]-N-[[3-(trifluoromethyl)phenyl]methyl]hexanamide (PubChem CID 118411694) has the molecular formula C23H28F3N3O and a molecular weight of 419.49 g/mol. Its IUPAC name is 2-amino-6-[[(1R,2S)-2-phenylcyclopropyl]amino]-N-[[3-(trifluoromethyl)phenyl]methyl]hexanamide.
| Compound Name | 2-amino-6-[[(1R,2S)-2-phenylcyclopropyl]amino]-N-[[3-(trifluoromethyl)phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 118411694 |
| Molecular Formula | C23H28F3N3O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-amino-6-[[(1R,2S)-2-phenylcyclopropyl]amino]-N-[[3-(trifluoromethyl)phenyl]methyl]hexanamide |
| SMILES | NC(CCCCN[C@@H]1C[C@H]1c1ccccc1)C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H28F3N3O/c24-23(25,26)18-10-6-7-16(13-18)15-29-22(30)20(27)11-4-5-12-28-21-14-19(21)17-8-2-1-3-9-17/h1-3,6-10,13,19-21,28H,4-5,11-12,14-15,27H2,(H,29,30)/t19-,20?,21+/m0/s1 |
| InChIKey | GHZIYOHPQXGDEF-SIGULFFNSA-N |
| XLogP | 3.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|