C15H22N2O — CID 131862373
2-amino-N-[(1S,2R)-2-phenylcyclopropyl]hexanamide (PubChem CID 131862373) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-amino-N-[(1S,2R)-2-phenylcyclopropyl]hexanamide.
| Compound Name | 2-amino-N-[(1S,2R)-2-phenylcyclopropyl]hexanamide |
|---|---|
| PubChem CID | 131862373 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-amino-N-[(1S,2R)-2-phenylcyclopropyl]hexanamide |
| SMILES | CCCCC(N)C(=O)N[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H22N2O/c1-2-3-9-13(16)15(18)17-14-10-12(14)11-7-5-4-6-8-11/h4-8,12-14H,2-3,9-10,16H2,1H3,(H,17,18)/t12-,13?,14+/m1/s1 |
| InChIKey | VPSCPBCVXMPJAR-YIOYIWSBSA-N |
| XLogP | 2.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |