C27H37N3O3 — CID 118411594
tert-butyl N-[1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]carbamate (PubChem CID 118411594) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is tert-butyl N-[1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 118411594 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | tert-butyl N-[1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCCN[C@@H]1C[C@H]1c1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H37N3O3/c1-27(2,3)33-26(32)30-23(25(31)29-19-20-12-6-4-7-13-20)16-10-11-17-28-24-18-22(24)21-14-8-5-9-15-21/h4-9,12-15,22-24,28H,10-11,16-19H2,1-3H3,(H,29,31)(H,30,32)/t22-,23?,24+/m0/s1 |
| InChIKey | GOUOIMIHEFZHQI-LIDAZEJRSA-N |
| XLogP | 4.51 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|