C28H39N3O3 — CID 118899217
tert-butyl N-[(2S)-1-[(3-methylphenyl)methylamino]-1-oxo-6-[(2-phenylcyclopropyl)amino]hexan-2-yl]carbamate (PubChem CID 118899217) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(3-methylphenyl)methylamino]-1-oxo-6-[(2-phenylcyclopropyl)amino]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(3-methylphenyl)methylamino]-1-oxo-6-[(2-phenylcyclopropyl)amino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 118899217 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(3-methylphenyl)methylamino]-1-oxo-6-[(2-phenylcyclopropyl)amino]hexan-2-yl]carbamate |
| SMILES | Cc1cccc(CNC(=O)[C@H](CCCCNC2CC2c2ccccc2)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C28H39N3O3/c1-20-11-10-12-21(17-20)19-30-26(32)24(31-27(33)34-28(2,3)4)15-8-9-16-29-25-18-23(25)22-13-6-5-7-14-22/h5-7,10-14,17,23-25,29H,8-9,15-16,18-19H2,1-4H3,(H,30,32)(H,31,33)/t23?,24-,25?/m0/s1 |
| InChIKey | VZQIMEFYETUTKU-BQCMWAFGSA-N |
| XLogP | 4.82 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|