C22H30Cl2FN3O — CID 118411559
2-amino-N-[(3-fluorophenyl)methyl]-6-[(2-phenylcyclopropyl)amino]hexanamide;dihydrochloride (PubChem CID 118411559) has the molecular formula C22H30Cl2FN3O and a molecular weight of 442.41 g/mol. Its IUPAC name is 2-amino-N-[(3-fluorophenyl)methyl]-6-[(2-phenylcyclopropyl)amino]hexanamide;dihydrochloride.
| Compound Name | 2-amino-N-[(3-fluorophenyl)methyl]-6-[(2-phenylcyclopropyl)amino]hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 118411559 |
| Molecular Formula | C22H30Cl2FN3O |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-amino-N-[(3-fluorophenyl)methyl]-6-[(2-phenylcyclopropyl)amino]hexanamide;dihydrochloride |
| SMILES | Cl.Cl.NC(CCCCNC1CC1c1ccccc1)C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C22H28FN3O.2ClH/c23-18-10-6-7-16(13-18)15-26-22(27)20(24)11-4-5-12-25-21-14-19(21)17-8-2-1-3-9-17;;/h1-3,6-10,13,19-21,25H,4-5,11-12,14-15,24H2,(H,26,27);2*1H |
| InChIKey | BLVANAVJHVAUDO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|