C32H39N5O3 — CID 90195721
1-N-(2-aminoethyl)-3-N-[(2S)-1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]benzene-1,3-dicarboxamide (PubChem CID 90195721) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-3-N-[(2S)-1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N-(2-aminoethyl)-3-N-[(2S)-1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 90195721 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 1-N-(2-aminoethyl)-3-N-[(2S)-1-(benzylamino)-1-oxo-6-[[(1R,2S)-2-phenylcyclopropyl]amino]hexan-2-yl]benzene-1,3-dicarboxamide |
| SMILES | NCCNC(=O)c1cccc(C(=O)N[C@@H](CCCCN[C@@H]2C[C@H]2c2ccccc2)C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C32H39N5O3/c33-17-19-35-30(38)25-14-9-15-26(20-25)31(39)37-28(32(40)36-22-23-10-3-1-4-11-23)16-7-8-18-34-29-21-27(29)24-12-5-2-6-13-24/h1-6,9-15,20,27-29,34H,7-8,16-19,21-22,33H2,(H,35,38)(H,36,40)(H,37,39)/t27-,28-,29+/m0/s1 |
| InChIKey | IREIHZCQUXIQGC-YTCPBCGMSA-N |
| XLogP | 3.11 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|