C29H37Cl2N3O4S — CID 159527879
3,4-dichloro-N-[(2S)-7-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxoheptan-2-yl]benzamide (PubChem CID 159527879) has the molecular formula C29H37Cl2N3O4S and a molecular weight of 594.61 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2S)-7-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxoheptan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[(2S)-7-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxoheptan-2-yl]benzamide |
|---|---|
| PubChem CID | 159527879 |
| Molecular Formula | C29H37Cl2N3O4S |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 3,4-dichloro-N-[(2S)-7-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]-1-(4-methylsulfonylpiperazin-1-yl)-1-oxoheptan-2-yl]benzamide |
| SMILES | Cc1ccc([C@@H]2C[C@H]2CCCCC[C@H](NC(=O)c2ccc(Cl)c(Cl)c2)C(=O)N2CCN(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C29H37Cl2N3O4S/c1-20-8-10-21(11-9-20)24-18-22(24)6-4-3-5-7-27(32-28(35)23-12-13-25(30)26(31)19-23)29(36)33-14-16-34(17-15-33)39(2,37)38/h8-13,19,22,24,27H,3-7,14-18H2,1-2H3,(H,32,35)/t22-,24+,27+/m1/s1 |
| InChIKey | UIMPKMDDKWORCN-SHQBLQIYSA-N |
| XLogP | 5.26 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|