C17H24FN3O5S — CID 123723921
4-fluoro-N-[5-hydroxy-1-(4-methylsulfonylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide (PubChem CID 123723921) has the molecular formula C17H24FN3O5S and a molecular weight of 401.46 g/mol. Its IUPAC name is 4-fluoro-N-[5-hydroxy-1-(4-methylsulfonylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[5-hydroxy-1-(4-methylsulfonylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 123723921 |
| Molecular Formula | C17H24FN3O5S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-fluoro-N-[5-hydroxy-1-(4-methylsulfonylpiperazin-1-yl)-1-oxopentan-2-yl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)C(CCCO)NC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H24FN3O5S/c1-27(25,26)21-10-8-20(9-11-21)17(24)15(3-2-12-22)19-16(23)13-4-6-14(18)7-5-13/h4-7,15,22H,2-3,8-12H2,1H3,(H,19,23) |
| InChIKey | XPXJFAKRQMODSQ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |