C18H28FN3O5S — CID 123258147
2-[[(4-fluorophenyl)-hydroxymethyl]-methylamino]-5-hydroxy-1-(4-methylsulfonylpiperazin-1-yl)pentan-1-one (PubChem CID 123258147) has the molecular formula C18H28FN3O5S and a molecular weight of 417.50 g/mol. Its IUPAC name is 2-[[(4-fluorophenyl)-hydroxymethyl]-methylamino]-5-hydroxy-1-(4-methylsulfonylpiperazin-1-yl)pentan-1-one.
| Compound Name | 2-[[(4-fluorophenyl)-hydroxymethyl]-methylamino]-5-hydroxy-1-(4-methylsulfonylpiperazin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 123258147 |
| Molecular Formula | C18H28FN3O5S |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[[(4-fluorophenyl)-hydroxymethyl]-methylamino]-5-hydroxy-1-(4-methylsulfonylpiperazin-1-yl)pentan-1-one |
| SMILES | CN(C(CCCO)C(=O)N1CCN(S(C)(=O)=O)CC1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H28FN3O5S/c1-20(17(24)14-5-7-15(19)8-6-14)16(4-3-13-23)18(25)21-9-11-22(12-10-21)28(2,26)27/h5-8,16-17,23-24H,3-4,9-13H2,1-2H3 |
| InChIKey | SQGLOHYTEGOMQI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|