C15H20BrFN2O3S — CID 75447544
1-[4-(bromomethylsulfonyl)piperazin-1-yl]-3-(4-fluorophenyl)butan-1-one (PubChem CID 75447544) has the molecular formula C15H20BrFN2O3S and a molecular weight of 407.31 g/mol. Its IUPAC name is 1-[4-(bromomethylsulfonyl)piperazin-1-yl]-3-(4-fluorophenyl)butan-1-one.
| Compound Name | 1-[4-(bromomethylsulfonyl)piperazin-1-yl]-3-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 75447544 |
| Molecular Formula | C15H20BrFN2O3S |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 1-[4-(bromomethylsulfonyl)piperazin-1-yl]-3-(4-fluorophenyl)butan-1-one |
| SMILES | CC(CC(=O)N1CCN(S(=O)(=O)CBr)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H20BrFN2O3S/c1-12(13-2-4-14(17)5-3-13)10-15(20)18-6-8-19(9-7-18)23(21,22)11-16/h2-5,12H,6-11H2,1H3 |
| InChIKey | AMXKHHPUEFXWDE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|