C21H22F4N2O4S — CID 55923966
3-(4-fluorophenyl)-1-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 55923966) has the molecular formula C21H22F4N2O4S and a molecular weight of 474.48 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | 3-(4-fluorophenyl)-1-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 55923966 |
| Molecular Formula | C21H22F4N2O4S |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | CC(CC(=O)N1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22F4N2O4S/c1-15(16-2-4-17(22)5-3-16)14-20(28)26-10-12-27(13-11-26)32(29,30)19-8-6-18(7-9-19)31-21(23,24)25/h2-9,15H,10-14H2,1H3 |
| InChIKey | VKTNGDZPKVOHSO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |