C18H26FN3O4S — CID 55940839
3-(4-fluorophenyl)-1-(4-morpholin-4-ylsulfonylpiperazin-1-yl)butan-1-one (PubChem CID 55940839) has the molecular formula C18H26FN3O4S and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(4-morpholin-4-ylsulfonylpiperazin-1-yl)butan-1-one.
| Compound Name | 3-(4-fluorophenyl)-1-(4-morpholin-4-ylsulfonylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 55940839 |
| Molecular Formula | C18H26FN3O4S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(4-morpholin-4-ylsulfonylpiperazin-1-yl)butan-1-one |
| SMILES | CC(CC(=O)N1CCN(S(=O)(=O)N2CCOCC2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H26FN3O4S/c1-15(16-2-4-17(19)5-3-16)14-18(23)20-6-8-21(9-7-20)27(24,25)22-10-12-26-13-11-22/h2-5,15H,6-14H2,1H3 |
| InChIKey | KUWJHMYLLGPCGY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |