C15H18FNO4 — CID 94710037
(3S)-3-(4-fluorophenyl)-5-morpholin-4-yl-5-oxopentanoic acid (PubChem CID 94710037) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-5-morpholin-4-yl-5-oxopentanoic acid.
| Compound Name | (3S)-3-(4-fluorophenyl)-5-morpholin-4-yl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 94710037 |
| Molecular Formula | C15H18FNO4 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-5-morpholin-4-yl-5-oxopentanoic acid |
| SMILES | O=C(O)C[C@H](CC(=O)N1CCOCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FNO4/c16-13-3-1-11(2-4-13)12(10-15(19)20)9-14(18)17-5-7-21-8-6-17/h1-4,12H,5-10H2,(H,19,20)/t12-/m0/s1 |
| InChIKey | QGURUHKFQAECGP-LBPRGKRZSA-N |
| XLogP | 1.63 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |