C19H27N3O5S — CID 123220711
N-methyl-N-[1-(4-methylsulfonylpiperazin-1-yl)-1,6-dioxohexan-2-yl]benzamide (PubChem CID 123220711) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-methyl-N-[1-(4-methylsulfonylpiperazin-1-yl)-1,6-dioxohexan-2-yl]benzamide.
| Compound Name | N-methyl-N-[1-(4-methylsulfonylpiperazin-1-yl)-1,6-dioxohexan-2-yl]benzamide |
|---|---|
| PubChem CID | 123220711 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-methyl-N-[1-(4-methylsulfonylpiperazin-1-yl)-1,6-dioxohexan-2-yl]benzamide |
| SMILES | CN(C(=O)c1ccccc1)C(CCCC=O)C(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C19H27N3O5S/c1-20(18(24)16-8-4-3-5-9-16)17(10-6-7-15-23)19(25)21-11-13-22(14-12-21)28(2,26)27/h3-5,8-9,15,17H,6-7,10-14H2,1-2H3 |
| InChIKey | KGIZQOBMAJKCQQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|