C11H20N2O5S — CID 141440981
2-(4-methylsulfonylpiperazin-1-yl)-6-oxohexanoic acid (PubChem CID 141440981) has the molecular formula C11H20N2O5S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-(4-methylsulfonylpiperazin-1-yl)-6-oxohexanoic acid.
| Compound Name | 2-(4-methylsulfonylpiperazin-1-yl)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 141440981 |
| Molecular Formula | C11H20N2O5S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-(4-methylsulfonylpiperazin-1-yl)-6-oxohexanoic acid |
| SMILES | CS(=O)(=O)N1CCN(C(CCCC=O)C(=O)O)CC1 |
| InChI | InChI=1S/C11H20N2O5S/c1-19(17,18)13-7-5-12(6-8-13)10(11(15)16)4-2-3-9-14/h9-10H,2-8H2,1H3,(H,15,16) |
| InChIKey | YZRQTCYICPYNBB-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|