C14H21N3O7S2 — CID 66870713
3-[(4-hydroxyphenyl)sulfonylamino]-2-(4-methylsulfonylpiperazin-1-yl)propanoic acid (PubChem CID 66870713) has the molecular formula C14H21N3O7S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)sulfonylamino]-2-(4-methylsulfonylpiperazin-1-yl)propanoic acid.
| Compound Name | 3-[(4-hydroxyphenyl)sulfonylamino]-2-(4-methylsulfonylpiperazin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 66870713 |
| Molecular Formula | C14H21N3O7S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 3-[(4-hydroxyphenyl)sulfonylamino]-2-(4-methylsulfonylpiperazin-1-yl)propanoic acid |
| SMILES | CS(=O)(=O)N1CCN(C(CNS(=O)(=O)c2ccc(O)cc2)C(=O)O)CC1 |
| InChI | InChI=1S/C14H21N3O7S2/c1-25(21,22)17-8-6-16(7-9-17)13(14(19)20)10-15-26(23,24)12-4-2-11(18)3-5-12/h2-5,13,15,18H,6-10H2,1H3,(H,19,20) |
| InChIKey | CKMQCAREONWELE-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |