C19H27N3O7S2 — CID 86675012
methyl (2S)-3-[(4-but-2-ynoxyphenyl)sulfonylamino]-2-(4-methylsulfonylpiperazin-1-yl)propanoate (PubChem CID 86675012) has the molecular formula C19H27N3O7S2 and a molecular weight of 473.57 g/mol. Its IUPAC name is methyl (2S)-3-[(4-but-2-ynoxyphenyl)sulfonylamino]-2-(4-methylsulfonylpiperazin-1-yl)propanoate.
| Compound Name | methyl (2S)-3-[(4-but-2-ynoxyphenyl)sulfonylamino]-2-(4-methylsulfonylpiperazin-1-yl)propanoate |
|---|---|
| PubChem CID | 86675012 |
| Molecular Formula | C19H27N3O7S2 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | methyl (2S)-3-[(4-but-2-ynoxyphenyl)sulfonylamino]-2-(4-methylsulfonylpiperazin-1-yl)propanoate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC[C@@H](C(=O)OC)N2CCN(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O7S2/c1-4-5-14-29-16-6-8-17(9-7-16)31(26,27)20-15-18(19(23)28-2)21-10-12-22(13-11-21)30(3,24)25/h6-9,18,20H,10-15H2,1-3H3/t18-/m0/s1 |
| InChIKey | GOIQGVKXHMYMQD-SFHVURJKSA-N |
| XLogP | -0.51 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|