C18H26N2O6S — CID 67494631
methyl (2S)-3-[[4-(cyclopropylmethoxy)phenyl]sulfonylamino]-2-morpholin-4-ylpropanoate (PubChem CID 67494631) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is methyl (2S)-3-[[4-(cyclopropylmethoxy)phenyl]sulfonylamino]-2-morpholin-4-ylpropanoate.
| Compound Name | methyl (2S)-3-[[4-(cyclopropylmethoxy)phenyl]sulfonylamino]-2-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 67494631 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl (2S)-3-[[4-(cyclopropylmethoxy)phenyl]sulfonylamino]-2-morpholin-4-ylpropanoate |
| SMILES | COC(=O)[C@H](CNS(=O)(=O)c1ccc(OCC2CC2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H26N2O6S/c1-24-18(21)17(20-8-10-25-11-9-20)12-19-27(22,23)16-6-4-15(5-7-16)26-13-14-2-3-14/h4-7,14,17,19H,2-3,8-13H2,1H3/t17-/m0/s1 |
| InChIKey | RETOUZJSNPEGDH-KRWDZBQOSA-N |
| XLogP | 0.63 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |