C12H25N3O5S2 — CID 154767021
2-[4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylpiperazin-1-yl]hexanoic acid (PubChem CID 154767021) has the molecular formula C12H25N3O5S2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-[4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylpiperazin-1-yl]hexanoic acid.
| Compound Name | 2-[4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylpiperazin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 154767021 |
| Molecular Formula | C12H25N3O5S2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylpiperazin-1-yl]hexanoic acid |
| SMILES | CCCCC(C(=O)O)N1CCN(S(=O)(=O)N=S(C)(C)=O)CC1 |
| InChI | InChI=1S/C12H25N3O5S2/c1-4-5-6-11(12(16)17)14-7-9-15(10-8-14)22(19,20)13-21(2,3)18/h11H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | HFJOYASAMNFSLM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |