C13H25N3O5S — CID 146134852
2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)pentanoic acid (PubChem CID 146134852) has the molecular formula C13H25N3O5S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)pentanoic acid.
| Compound Name | 2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 146134852 |
| Molecular Formula | C13H25N3O5S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)pentanoic acid |
| SMILES | CCCC(C(=O)O)N1CCN(S(=O)(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C13H25N3O5S/c1-2-3-12(13(17)18)14-4-6-15(7-5-14)22(19,20)16-8-10-21-11-9-16/h12H,2-11H2,1H3,(H,17,18) |
| InChIKey | PYLDWYNNPSZWPU-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |