About 2-morpholin-4-yldecanoic acid
2-morpholin-4-yldecanoic acid (PubChem CID 57259608) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is 2-morpholin-4-yldecanoic acid.
Molecular Properties
| Compound Name | 2-morpholin-4-yldecanoic acid |
| PubChem CID | 57259608 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 2-morpholin-4-yldecanoic acid |
| SMILES | CCCCCCCCC(C(=O)O)N1CCOCC1 |
| InChI | InChI=1S/C14H27NO3/c1-2-3-4-5-6-7-8-13(14(16)17)15-9-11-18-12-10-15/h13H,2-12H2,1H3,(H,16,17) |
| InChIKey | SECQNJQAASOWLR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-yldecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yldecanoic acid?
The IUPAC name of 2-morpholin-4-yldecanoic acid (CID 57259608) is 2-morpholin-4-yldecanoic acid.
What is the SMILES notation for 2-morpholin-4-yldecanoic acid?
The canonical SMILES for 2-morpholin-4-yldecanoic acid is CCCCCCCCC(C(=O)O)N1CCOCC1.
What is the InChIKey of 2-morpholin-4-yldecanoic acid?
The InChIKey is SECQNJQAASOWLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-2-3-4-5-6-7-8-13(14(16)17)15-9-11-18-12-10-15/h13H,2-12H2,1H3,(H,16,17).
What are the key properties of 2-morpholin-4-yldecanoic acid?
2-morpholin-4-yldecanoic acid has a molecular weight of 257.37 g/mol, XLogP of 2.52, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yldecanoic acid is sourced from PubChem (CID 57259608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).