C11H21NO2 — CID 43866463
2-(azepan-1-yl)pentanoic acid (PubChem CID 43866463) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-(azepan-1-yl)pentanoic acid.
| Compound Name | 2-(azepan-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 43866463 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-(azepan-1-yl)pentanoic acid |
| SMILES | CCCC(C(=O)O)N1CCCCCC1 |
| InChI | InChI=1S/C11H21NO2/c1-2-7-10(11(13)14)12-8-5-3-4-6-9-12/h10H,2-9H2,1H3,(H,13,14) |
| InChIKey | JQALIYSLILRQFD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |