2-(azepan-1-yl)pentanoic acid

C11H21NO2 — CID 43866463

IUPAC2-(azepan-1-yl)pentanoic acid
SMILESCCCC(C(=O)O)N1CCCCCC1
InChIInChI=1S/C11H21NO2/c1-2-7-10(11(13)14)12-8-5-3-4-6-9-12/h10H,2-9H2,1H3,(H,13,14)
InChIKeyJQALIYSLILRQFD-UHFFFAOYSA-N
MW199.29 g/mol
LogP2.12
Rot. Bonds4

About 2-(azepan-1-yl)pentanoic acid

2-(azepan-1-yl)pentanoic acid (PubChem CID 43866463) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-(azepan-1-yl)pentanoic acid.

Molecular Properties

Compound Name2-(azepan-1-yl)pentanoic acid
PubChem CID43866463
Molecular FormulaC11H21NO2
Molecular Weight199.29 g/mol
Exact Mass199.16
IUPAC Name2-(azepan-1-yl)pentanoic acid
SMILESCCCC(C(=O)O)N1CCCCCC1
InChIInChI=1S/C11H21NO2/c1-2-7-10(11(13)14)12-8-5-3-4-6-9-12/h10H,2-9H2,1H3,(H,13,14)
InChIKeyJQALIYSLILRQFD-UHFFFAOYSA-N
XLogP2.12
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.29
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(azepan-1-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(azepan-1-yl)pentanoic acid?
The IUPAC name of 2-(azepan-1-yl)pentanoic acid (CID 43866463) is 2-(azepan-1-yl)pentanoic acid.
What is the SMILES notation for 2-(azepan-1-yl)pentanoic acid?
The canonical SMILES for 2-(azepan-1-yl)pentanoic acid is CCCC(C(=O)O)N1CCCCCC1.
What is the InChIKey of 2-(azepan-1-yl)pentanoic acid?
The InChIKey is JQALIYSLILRQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-2-7-10(11(13)14)12-8-5-3-4-6-9-12/h10H,2-9H2,1H3,(H,13,14).
What are the key properties of 2-(azepan-1-yl)pentanoic acid?
2-(azepan-1-yl)pentanoic acid has a molecular weight of 199.29 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-yl)pentanoic acid is sourced from PubChem (CID 43866463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).