C11H21NO2S — CID 103090125
5-methylsulfanyl-2-piperidin-1-ylpentanoic acid (PubChem CID 103090125) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 5-methylsulfanyl-2-piperidin-1-ylpentanoic acid.
| Compound Name | 5-methylsulfanyl-2-piperidin-1-ylpentanoic acid |
|---|---|
| PubChem CID | 103090125 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 5-methylsulfanyl-2-piperidin-1-ylpentanoic acid |
| SMILES | CSCCCC(C(=O)O)N1CCCCC1 |
| InChI | InChI=1S/C11H21NO2S/c1-15-9-5-6-10(11(13)14)12-7-3-2-4-8-12/h10H,2-9H2,1H3,(H,13,14) |
| InChIKey | GIXUFJIFZXYMLJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|