C20H34N4O9S — CID 178094289
5-methylsulfanyl-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid (PubChem CID 178094289) has the molecular formula C20H34N4O9S and a molecular weight of 506.58 g/mol. Its IUPAC name is 5-methylsulfanyl-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid.
| Compound Name | 5-methylsulfanyl-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 178094289 |
| Molecular Formula | C20H34N4O9S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 5-methylsulfanyl-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
| SMILES | CSC(=O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H34N4O9S/c1-34-19(31)3-2-15(20(32)33)24-10-8-22(13-17(27)28)6-4-21(12-16(25)26)5-7-23(9-11-24)14-18(29)30/h15H,2-14H2,1H3,(H,25,26)(H,27,28)(H,29,30)(H,32,33) |
| InChIKey | KGOLJTWZMWJDLU-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 179.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|