C25H41N4O10Y- — CID 155716047
2-[4,10-bis(carboxymethyl)-7-(1-carboxy-4-oxobutyl)-1,4,7,10-tetrazacyclododec-1-yl]-6-methyl-5-oxoheptanoic acid;yttrium (PubChem CID 155716047) has the molecular formula C25H41N4O10Y- and a molecular weight of 646.53 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-(1-carboxy-4-oxobutyl)-1,4,7,10-tetrazacyclododec-1-yl]-6-methyl-5-oxoheptanoic acid;yttrium.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-(1-carboxy-4-oxobutyl)-1,4,7,10-tetrazacyclododec-1-yl]-6-methyl-5-oxoheptanoic acid;yttrium |
|---|---|
| PubChem CID | 155716047 |
| Molecular Formula | C25H41N4O10Y- |
| Molecular Weight | 646.53 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-(1-carboxy-4-oxobutyl)-1,4,7,10-tetrazacyclododec-1-yl]-6-methyl-5-oxoheptanoic acid;yttrium |
| SMILES | CC(C)C(=O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(C(CC[C-]=O)C(=O)O)CCN(CC(=O)O)CC1.[Y] |
| InChI | InChI=1S/C25H41N4O10.Y/c1-18(2)21(31)6-5-20(25(38)39)29-13-9-26(16-22(32)33)7-11-28(19(24(36)37)4-3-15-30)12-8-27(10-14-29)17-23(34)35;/h18-20H,3-14,16-17H2,1-2H3,(H,32,33)(H,34,35)(H,36,37)(H,38,39);/q-1; |
| InChIKey | BDIIOONADGRNKJ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 196.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.53 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|