C18H31N3O7 — CID 172528167
2-[4-(carboxymethyl)-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]-6-methyl-5-oxoheptanoic acid (PubChem CID 172528167) has the molecular formula C18H31N3O7 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]-6-methyl-5-oxoheptanoic acid.
| Compound Name | 2-[4-(carboxymethyl)-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]-6-methyl-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 172528167 |
| Molecular Formula | C18H31N3O7 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-(formyloxymethyl)-1,4,7-triazonan-1-yl]-6-methyl-5-oxoheptanoic acid |
| SMILES | CC(C)C(=O)CCC(C(=O)O)N1CCN(COC=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H31N3O7/c1-14(2)16(23)4-3-15(18(26)27)21-9-7-19(11-17(24)25)5-6-20(8-10-21)12-28-13-22/h13-15H,3-12H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | UNZPSOWWVQBMNN-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|