C22H40N4O8 — CID 162501106
2-[4,7-bis(carboxymethyl)-10-(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5,5-dimethylhexanoic acid (PubChem CID 162501106) has the molecular formula C22H40N4O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5,5-dimethylhexanoic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 162501106 |
| Molecular Formula | C22H40N4O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CCC(C(=O)O)N1CCN(COC=O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C22H40N4O8/c1-22(2,3)5-4-18(21(32)33)26-12-10-24(15-20(30)31)7-6-23(14-19(28)29)8-9-25(11-13-26)16-34-17-27/h17-18H,4-16H2,1-3H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | YQUOIOOMEFXPEV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 151.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|