C10H19N3O4 — CID 162694230
2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 162694230) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 162694230 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=COCN1CCNCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C10H19N3O4/c14-9-17-8-13-4-2-11-1-3-12(5-6-13)7-10(15)16/h9,11H,1-8H2,(H,15,16) |
| InChIKey | GRYLHMMKUHNUCO-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|