2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid

C10H19N3O4 — CID 162694230

IUPAC2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid
SMILESO=COCN1CCNCCN(CC(=O)O)CC1
InChIInChI=1S/C10H19N3O4/c14-9-17-8-13-4-2-11-1-3-12(5-6-13)7-10(15)16/h9,11H,1-8H2,(H,15,16)
InChIKeyGRYLHMMKUHNUCO-UHFFFAOYSA-N
MW245.28 g/mol
LogP-1.59
Rot. Bonds5

About 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid

2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 162694230) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid
PubChem CID162694230
Molecular FormulaC10H19N3O4
Molecular Weight245.28 g/mol
Exact Mass245.14
IUPAC Name2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid
SMILESO=COCN1CCNCCN(CC(=O)O)CC1
InChIInChI=1S/C10H19N3O4/c14-9-17-8-13-4-2-11-1-3-12(5-6-13)7-10(15)16/h9,11H,1-8H2,(H,15,16)
InChIKeyGRYLHMMKUHNUCO-UHFFFAOYSA-N
XLogP-1.59
TPSA82.11 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 5-1.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid?
The IUPAC name of 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid (CID 162694230) is 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid is O=COCN1CCNCCN(CC(=O)O)CC1.
What is the InChIKey of 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid?
The InChIKey is GRYLHMMKUHNUCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O4/c14-9-17-8-13-4-2-11-1-3-12(5-6-13)7-10(15)16/h9,11H,1-8H2,(H,15,16).
What are the key properties of 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid?
2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid has a molecular weight of 245.28 g/mol, XLogP of -1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(formyloxymethyl)-1,4,7-triazonan-1-yl]acetic acid is sourced from PubChem (CID 162694230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).