C31H64N8O11 — CID 157228326
2-[4-(1,3-dihydroxypentan-2-yl)-7,10-bis(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;3-(1,4,7,10-tetrazacyclododec-1-yl)butane-1,2,4-triol (PubChem CID 157228326) has the molecular formula C31H64N8O11 and a molecular weight of 724.90 g/mol. Its IUPAC name is 2-[4-(1,3-dihydroxypentan-2-yl)-7,10-bis(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;3-(1,4,7,10-tetrazacyclododec-1-yl)butane-1,2,4-triol.
| Compound Name | 2-[4-(1,3-dihydroxypentan-2-yl)-7,10-bis(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;3-(1,4,7,10-tetrazacyclododec-1-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 157228326 |
| Molecular Formula | C31H64N8O11 |
| Molecular Weight | 724.90 g/mol |
| Exact Mass | 724.47 |
| IUPAC Name | 2-[4-(1,3-dihydroxypentan-2-yl)-7,10-bis(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;3-(1,4,7,10-tetrazacyclododec-1-yl)butane-1,2,4-triol |
| SMILES | CCC(O)C(CO)N1CCN(COC=O)CCN(COC=O)CCN(CC(=O)O)CC1.OCC(O)C(CO)N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C19H36N4O8.C12H28N4O3/c1-2-18(27)17(12-24)23-9-7-20(11-19(28)29)3-4-21(13-30-15-25)5-6-22(8-10-23)14-31-16-26;17-9-11(12(19)10-18)16-7-5-14-3-1-13-2-4-15-6-8-16/h15-18,24,27H,2-14H2,1H3,(H,28,29);11-15,17-19H,1-10H2 |
| InChIKey | ATUTXOOLOCLHSW-UHFFFAOYSA-N |
| XLogP | -5.53 |
| TPSA | 243.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.90 |
| LogP ≤ 5 | -5.53 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|