C13H28N4O4 — CID 171935508
7-[(2S,3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1-carbaldehyde (PubChem CID 171935508) has the molecular formula C13H28N4O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 7-[(2S,3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1-carbaldehyde.
| Compound Name | 7-[(2S,3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1-carbaldehyde |
|---|---|
| PubChem CID | 171935508 |
| Molecular Formula | C13H28N4O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 7-[(2S,3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1-carbaldehyde |
| SMILES | O=CN1CCNCCN([C@@H](CO)[C@@H](O)CO)CCNCC1 |
| InChI | InChI=1S/C13H28N4O4/c18-9-12(13(21)10-19)17-7-3-14-1-5-16(11-20)6-2-15-4-8-17/h11-15,18-19,21H,1-10H2/t12-,13-/m0/s1 |
| InChIKey | SJRGNCCIMUFOLM-STQMWFEESA-N |
| XLogP | -3.35 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|