C8H18N2O2 — CID 163627415
3-piperazin-1-ylbutane-1,2-diol (PubChem CID 163627415) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-piperazin-1-ylbutane-1,2-diol.
| Compound Name | 3-piperazin-1-ylbutane-1,2-diol |
|---|---|
| PubChem CID | 163627415 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-piperazin-1-ylbutane-1,2-diol |
| SMILES | CC(C(O)CO)N1CCNCC1 |
| InChI | InChI=1S/C8H18N2O2/c1-7(8(12)6-11)10-4-2-9-3-5-10/h7-9,11-12H,2-6H2,1H3 |
| InChIKey | HTEOTFSSBDRWBX-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |