C14H30N4O4 — CID 70614432
1,6-di(piperazin-1-yl)hexane-1,2,5,6-tetrol (PubChem CID 70614432) has the molecular formula C14H30N4O4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1,6-di(piperazin-1-yl)hexane-1,2,5,6-tetrol.
| Compound Name | 1,6-di(piperazin-1-yl)hexane-1,2,5,6-tetrol |
|---|---|
| PubChem CID | 70614432 |
| Molecular Formula | C14H30N4O4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1,6-di(piperazin-1-yl)hexane-1,2,5,6-tetrol |
| SMILES | OC(CCC(O)C(O)N1CCNCC1)C(O)N1CCNCC1 |
| InChI | InChI=1S/C14H30N4O4/c19-11(13(21)17-7-3-15-4-8-17)1-2-12(20)14(22)18-9-5-16-6-10-18/h11-16,19-22H,1-10H2 |
| InChIKey | LKHVZWUNGJXPER-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |