C8H18N2O2 — CID 163688577
(2S)-2-methyl-1-piperazin-1-ylpropane-1,3-diol (PubChem CID 163688577) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is (2S)-2-methyl-1-piperazin-1-ylpropane-1,3-diol.
| Compound Name | (2S)-2-methyl-1-piperazin-1-ylpropane-1,3-diol |
|---|---|
| PubChem CID | 163688577 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (2S)-2-methyl-1-piperazin-1-ylpropane-1,3-diol |
| SMILES | C[C@@H](CO)C(O)N1CCNCC1 |
| InChI | InChI=1S/C8H18N2O2/c1-7(6-11)8(12)10-4-2-9-3-5-10/h7-9,11-12H,2-6H2,1H3/t7-,8?/m0/s1 |
| InChIKey | JRAKDJQDSXYGFJ-JAMMHHFISA-N |
| XLogP | -1.16 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |