About morpholine;1-piperazin-1-ylethanol
morpholine;1-piperazin-1-ylethanol (PubChem CID 67676153) has the molecular formula C10H23N3O2
and a molecular weight of 217.31 g/mol. Its IUPAC name is morpholine;1-piperazin-1-ylethanol.
Molecular Properties
| Compound Name | morpholine;1-piperazin-1-ylethanol |
| PubChem CID | 67676153 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | morpholine;1-piperazin-1-ylethanol |
| SMILES | C1COCCN1.CC(O)N1CCNCC1 |
| InChI | InChI=1S/C6H14N2O.C4H9NO/c1-6(9)8-4-2-7-3-5-8;1-3-6-4-2-5-1/h6-7,9H,2-5H2,1H3;5H,1-4H2 |
| InChIKey | JFYVRBMYGFGSKS-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze morpholine;1-piperazin-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;1-piperazin-1-ylethanol?
The IUPAC name of morpholine;1-piperazin-1-ylethanol (CID 67676153) is morpholine;1-piperazin-1-ylethanol.
What is the SMILES notation for morpholine;1-piperazin-1-ylethanol?
The canonical SMILES for morpholine;1-piperazin-1-ylethanol is C1COCCN1.CC(O)N1CCNCC1.
What is the InChIKey of morpholine;1-piperazin-1-ylethanol?
The InChIKey is JFYVRBMYGFGSKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.C4H9NO/c1-6(9)8-4-2-7-3-5-8;1-3-6-4-2-5-1/h6-7,9H,2-5H2,1H3;5H,1-4H2.
What are the key properties of morpholine;1-piperazin-1-ylethanol?
morpholine;1-piperazin-1-ylethanol has a molecular weight of 217.31 g/mol, XLogP of -1.16, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;1-piperazin-1-ylethanol is sourced from PubChem (CID 67676153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).