About 1,4-dimethylpiperazine;morpholine
1,4-dimethylpiperazine;morpholine (PubChem CID 157159572) has the molecular formula C10H23N3O
and a molecular weight of 201.31 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;morpholine.
Molecular Properties
| Compound Name | 1,4-dimethylpiperazine;morpholine |
| PubChem CID | 157159572 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 1,4-dimethylpiperazine;morpholine |
| SMILES | C1COCCN1.CN1CCN(C)CC1 |
| InChI | InChI=1S/C6H14N2.C4H9NO/c1-7-3-5-8(2)6-4-7;1-3-6-4-2-5-1/h3-6H2,1-2H3;5H,1-4H2 |
| InChIKey | AMFCEUIGJROFOX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dimethylpiperazine;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpiperazine;morpholine?
The IUPAC name of 1,4-dimethylpiperazine;morpholine (CID 157159572) is 1,4-dimethylpiperazine;morpholine.
What is the SMILES notation for 1,4-dimethylpiperazine;morpholine?
The canonical SMILES for 1,4-dimethylpiperazine;morpholine is C1COCCN1.CN1CCN(C)CC1.
What is the InChIKey of 1,4-dimethylpiperazine;morpholine?
The InChIKey is AMFCEUIGJROFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C4H9NO/c1-7-3-5-8(2)6-4-7;1-3-6-4-2-5-1/h3-6H2,1-2H3;5H,1-4H2.
What are the key properties of 1,4-dimethylpiperazine;morpholine?
1,4-dimethylpiperazine;morpholine has a molecular weight of 201.31 g/mol, XLogP of -0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpiperazine;morpholine is sourced from PubChem (CID 157159572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).