C12H27N3O — CID 20610192
5,11-dimethyl-1-oxa-5,8,11-triazacyclotetradecane (PubChem CID 20610192) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 5,11-dimethyl-1-oxa-5,8,11-triazacyclotetradecane.
| Compound Name | 5,11-dimethyl-1-oxa-5,8,11-triazacyclotetradecane |
|---|---|
| PubChem CID | 20610192 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 5,11-dimethyl-1-oxa-5,8,11-triazacyclotetradecane |
| SMILES | CN1CCCOCCCN(C)CCNCC1 |
| InChI | InChI=1S/C12H27N3O/c1-14-7-3-11-16-12-4-8-15(2)10-6-13-5-9-14/h13H,3-12H2,1-2H3 |
| InChIKey | KHOBQUNVIVGCOB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |