C13H29N5 — CID 58730173
7-methyl-1,4,7,10,13-pentazabicyclo[11.2.2]heptadecane (PubChem CID 58730173) has the molecular formula C13H29N5 and a molecular weight of 255.41 g/mol. Its IUPAC name is 7-methyl-1,4,7,10,13-pentazabicyclo[11.2.2]heptadecane.
| Compound Name | 7-methyl-1,4,7,10,13-pentazabicyclo[11.2.2]heptadecane |
|---|---|
| PubChem CID | 58730173 |
| Molecular Formula | C13H29N5 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.24 |
| IUPAC Name | 7-methyl-1,4,7,10,13-pentazabicyclo[11.2.2]heptadecane |
| SMILES | CN1CCNCCN2CCN(CCNCC1)CC2 |
| InChI | InChI=1S/C13H29N5/c1-16-6-2-14-4-8-17-10-12-18(13-11-17)9-5-15-3-7-16/h14-15H,2-13H2,1H3 |
| InChIKey | ICOHLLFQMLHGQC-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|