C14H33N5 — CID 13461315
1,4,7,10-tetramethyl-1,4,7,10,13-pentazacyclopentadecane (PubChem CID 13461315) has the molecular formula C14H33N5 and a molecular weight of 271.45 g/mol. Its IUPAC name is 1,4,7,10-tetramethyl-1,4,7,10,13-pentazacyclopentadecane.
| Compound Name | 1,4,7,10-tetramethyl-1,4,7,10,13-pentazacyclopentadecane |
|---|---|
| PubChem CID | 13461315 |
| Molecular Formula | C14H33N5 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.27 |
| IUPAC Name | 1,4,7,10-tetramethyl-1,4,7,10,13-pentazacyclopentadecane |
| SMILES | CN1CCNCCN(C)CCN(C)CCN(C)CC1 |
| InChI | InChI=1S/C14H33N5/c1-16-7-5-15-6-8-17(2)10-12-19(4)14-13-18(3)11-9-16/h15H,5-14H2,1-4H3 |
| InChIKey | UEWWNUVBLKXKBF-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 24.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |