About 4-methylpiperazin-1-amine;1-methylpiperazine
4-methylpiperazin-1-amine;1-methylpiperazine (PubChem CID 158167990) has the molecular formula C10H25N5
and a molecular weight of 215.34 g/mol. Its IUPAC name is 4-methylpiperazin-1-amine;1-methylpiperazine.
Molecular Properties
| Compound Name | 4-methylpiperazin-1-amine;1-methylpiperazine |
| PubChem CID | 158167990 |
| Molecular Formula | C10H25N5 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.21 |
| IUPAC Name | 4-methylpiperazin-1-amine;1-methylpiperazine |
| SMILES | CN1CCN(N)CC1.CN1CCNCC1 |
| InChI | InChI=1S/C5H13N3.C5H12N2/c1-7-2-4-8(6)5-3-7;1-7-4-2-6-3-5-7/h2-6H2,1H3;6H,2-5H2,1H3 |
| InChIKey | FXBVGYBHRUPVSR-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpiperazin-1-amine;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpiperazin-1-amine;1-methylpiperazine?
The IUPAC name of 4-methylpiperazin-1-amine;1-methylpiperazine (CID 158167990) is 4-methylpiperazin-1-amine;1-methylpiperazine.
What is the SMILES notation for 4-methylpiperazin-1-amine;1-methylpiperazine?
The canonical SMILES for 4-methylpiperazin-1-amine;1-methylpiperazine is CN1CCN(N)CC1.CN1CCNCC1.
What is the InChIKey of 4-methylpiperazin-1-amine;1-methylpiperazine?
The InChIKey is FXBVGYBHRUPVSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3.C5H12N2/c1-7-2-4-8(6)5-3-7;1-7-4-2-6-3-5-7/h2-6H2,1H3;6H,2-5H2,1H3.
What are the key properties of 4-methylpiperazin-1-amine;1-methylpiperazine?
4-methylpiperazin-1-amine;1-methylpiperazine has a molecular weight of 215.34 g/mol, XLogP of -1.37, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpiperazin-1-amine;1-methylpiperazine is sourced from PubChem (CID 158167990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).